CAS 1031-92-1
:1-[(4-chlorophenyl)(phenyl)methyl]piperazine dihydrochloride
Description:
1-[(4-chlorophenyl)(phenyl)methyl]piperazine dihydrochloride, with the CAS number 1031-92-1, is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a 4-chlorophenyl group and a phenyl group attached to a methyl group, contributing to its unique structural properties. It is typically encountered as a dihydrochloride salt, which enhances its solubility in water and other polar solvents. The presence of the chlorophenyl moiety may impart specific biological activities, making it of interest in pharmaceutical research. The compound is often studied for its potential applications in medicinal chemistry, particularly in the development of psychoactive agents or as a scaffold for drug design. Its physical properties, such as melting point and solubility, can vary based on the form and purity of the substance. As with many piperazine derivatives, it may exhibit a range of pharmacological effects, necessitating careful evaluation in laboratory settings.
Formula:C17H21Cl3N2
InChI:InChI=1/C17H19ClN2.2ClH/c18-16-8-6-15(7-9-16)17(14-4-2-1-3-5-14)20-12-10-19-11-13-20;;/h1-9,17,19H,10-13H2;2*1H
SMILES:c1ccc(cc1)C(c1ccc(cc1)Cl)N1CCNCC1.Cl.Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.

