CymitQuimica logo

CAS 103124-72-7

:

8-bromo-2,3,4-trichlorodibenzo[b,d]furan

Description:
8-Bromo-2,3,4-trichlorodibenzo[b,d]furan is a halogenated organic compound characterized by its complex polycyclic structure, which includes a dibenzo[b,d]furan core with multiple halogen substituents. The presence of bromine and chlorine atoms contributes to its chemical reactivity and potential environmental persistence. This compound is typically studied for its potential applications in organic synthesis and its implications in environmental chemistry, particularly concerning its stability and bioaccumulation in ecosystems. Its molecular structure suggests that it may exhibit unique electronic properties, influencing its interactions with biological systems. Additionally, the halogen substituents can affect the compound's solubility, volatility, and toxicity, making it of interest in toxicological studies. As with many halogenated compounds, there may be concerns regarding its environmental impact and regulatory status, particularly in relation to persistent organic pollutants. Overall, 8-bromo-2,3,4-trichlorodibenzo[b,d]furan represents a significant subject of study within the fields of organic chemistry and environmental science.
Formula:C12H4BrCl3O
InChI:InChI=1/C12H4BrCl3O/c13-5-1-2-9-6(3-5)7-4-8(14)10(15)11(16)12(7)17-9/h1-4H
SMILES:c1cc2c(cc1Br)c1cc(c(c(c1o2)Cl)Cl)Cl
Synonyms:
  • Dibenzofuran, 8-Bromo-2,3,4-Trichloro-
  • 8-Bromo-2,3,4-trichlorodibenzo[b,d]furan
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.