CAS 10313-98-1
:4-(1,1-dioxido-3-oxo-1,2-benzothiazol-2(3H)-yl)butanenitrile
Description:
4-(1,1-Dioxido-3-oxo-1,2-benzothiazol-2(3H)-yl)butanenitrile, with the CAS number 10313-98-1, is a chemical compound that features a benzothiazole moiety, which is known for its diverse biological activities. This compound contains a butanenitrile group, contributing to its potential reactivity and applications in organic synthesis. The presence of the dioxido and keto functional groups suggests that it may exhibit unique chemical properties, such as the ability to participate in various reactions, including nucleophilic additions or substitutions. Benzothiazole derivatives are often studied for their pharmacological properties, including antimicrobial and anticancer activities. The compound's structure indicates it may also have applications in materials science or as a precursor in the synthesis of more complex molecules. However, specific data regarding its solubility, stability, and toxicity would require further investigation through experimental studies or literature reviews. Overall, this compound represents a class of organic molecules with potential utility in both medicinal chemistry and industrial applications.
Formula:C11H10N2O3S
InChI:InChI=1/C11H10N2O3S/c12-7-3-4-8-13-11(14)9-5-1-2-6-10(9)17(13,15)16/h1-2,5-6H,3-4,8H2
SMILES:c1ccc2c(c1)C(=O)N(CCCC#N)S2(=O)=O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.