CAS 103130-45-6

(6R)-2-amino-6-[(1R,2S)-1,2-dihydroxypropyl]-5,6,7,8-tetrahydro-3H-pteridin-4-one; sulfuric acid

Description:

The chemical substance known as (6R)-2-amino-6-[(1R,2S)-1,2-dihydroxypropyl]-5,6,7,8-tetrahydro-3H-pteridin-4-one, with the CAS number 103130-45-6, is a pteridine derivative that exhibits a complex structure characterized by a bicyclic pteridine ring system. This compound features an amino group and a hydroxyl group, which contribute to its potential biological activity. The presence of the tetrahydro configuration indicates that it is a saturated derivative, which may influence its solubility and reactivity. The compound is often studied for its role in biological systems, particularly in relation to its potential as a cofactor or substrate in enzymatic reactions. Additionally, the inclusion of sulfuric acid suggests that it may be involved in specific chemical reactions or processes, possibly as a catalyst or in the formation of salts. Overall, this compound's unique structural features and functional groups make it of interest in both synthetic and medicinal chemistry contexts.

Formula: C₉H₁₇N₅O₇S

InChI: InChI=1/C9H15N5O3.H2O4S/c1-3(15)6(16)4-2-11-7-5(12-4)8(17)14-9(10)13-7;1-5(2,3)4/h3-4,6,12,15-16H,2H2,1H3,(H4,10,11,13,14,17);(H2,1,2,3,4)/t3-,4+,6-;/m0./s1

(6S)-Tetrahydro-L-biopterin Disulfate, >80%

CAS: 103130-45-6

Formula: C₉H₁₅N₅O₃·H₂O₄S

Purity: >80%

Color and Shape: Neat

Ref: TR-T293180