CAS 103141-09-9

N-(4-methoxyphenyl)-1-phenyl-1H-pyrazol-3-amine

Description:

N-(4-methoxyphenyl)-1-phenyl-1H-pyrazol-3-amine, with the CAS number 103141-09-9, is an organic compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features a phenyl group and a methoxy-substituted phenyl group, contributing to its aromatic character and potentially influencing its solubility and reactivity. The presence of the amine functional group suggests that it may participate in hydrogen bonding, which can affect its physical properties, such as melting point and boiling point. Additionally, the methoxy group can enhance the compound's lipophilicity and may influence its biological activity. This compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, as modifications to the pyrazole structure can lead to diverse pharmacological properties. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its stability and reactivity would be assessed under various conditions to determine its suitability for specific applications.

Formula: C₁₆H₁₅N₃O

InChI: InChI=1/C16H15N3O/c1-20-15-9-7-13(8-10-15)17-16-11-12-19(18-16)14-5-3-2-4-6-14/h2-12H,1H3,(H,17,18)

Synonyms:

• 1H-Pyrazol-3-amine, N-(4-methoxyphenyl)-1-phenyl-

FPL 62064

CAS: 103141-09-9

Formula: C₁₆H₁₅N₃O

Purity: 99%

Color and Shape: Solid

Molecular weight: 265.3098

Ref: IN-DA0096D0

FPL 62064

CAS: 103141-09-9

FPL 62064

Purity: ≥98%

Molecular weight: 265.31g/mol

Ref: 54-BUP08762

N-(4-Methoxyphenyl)-1-Phenyl-1H-Pyrazol-3-Amine

CAS: 103141-09-9

N-(4-Methoxyphenyl)-1-Phenyl-1H-Pyrazol-3-Amine

Purity: 99%

Molecular weight: 265.31g/mol

Ref: 54-OR1024021

FPL 62064

CAS: 103141-09-9

FPL 62064 is a potent dual inhibitor of 5-lipoxygenase (5-LOX) and COX (IC50 of 3.5 μM and 3.1 μM for RBL-1 cytosolic 5-lipoxygenase and prostaglandin

Formula: C₁₆H₁₅N₃O

Purity: 98.79%

Color and Shape: Solid

Molecular weight: 265.31

Ref: TM-T8356

N-(4-Methoxyphenyl)-1-phenyl-1H-pyrazol-3-amine

CAS: 103141-09-9

Purity: 95.0%

Molecular weight: 265.3160095214844

Ref: 10-F339590