CAS 1031417-75-0
:3,7-Dimethyl-1H-indazole-5-carboxylic acid
Description:
3,7-Dimethyl-1H-indazole-5-carboxylic acid is a chemical compound characterized by its indazole core, which features a five-membered ring containing two nitrogen atoms. The presence of two methyl groups at the 3 and 7 positions contributes to its unique structural properties, while the carboxylic acid functional group at the 5 position enhances its reactivity and solubility in polar solvents. This compound is typically used in pharmaceutical research and development due to its potential biological activity. It may exhibit properties such as anti-inflammatory or analgesic effects, although specific biological activities would depend on further empirical studies. The compound's molecular structure allows for various synthetic modifications, making it a versatile intermediate in organic synthesis. Additionally, its stability under standard laboratory conditions and its ability to form salts with bases are important characteristics that facilitate its handling and application in various chemical processes. As with many organic compounds, safety data sheets should be consulted for handling and toxicity information.
Formula:C10H10N2O2
InChI:InChI=1S/C10H10N2O2/c1-5-3-7(10(13)14)4-8-6(2)11-12-9(5)8/h3-4H,1-2H3,(H,11,12)(H,13,14)
InChI key:InChIKey=ZPWKLSSETKSKAL-UHFFFAOYSA-N
SMILES:CC=1C=2C(=C(C)C=C(C(O)=O)C2)NN1
Synonyms:- 3,7-Dimethyl-2H-indazole-5-carboxylic acid
- 3,7-Dimethyl-1H-indazole-5-carboxylic acid
- 1H-Indazole-5-carboxylic acid, 3,7-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.