CymitQuimica logo

CAS 1031417-77-2

:

1-Methyl-1H-indazole-6-carboxylic acid

Description:
1-Methyl-1H-indazole-6-carboxylic acid is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a carboxylic acid functional group (-COOH) at the 6-position and a methyl group (-CH3) at the 1-position contributes to its unique chemical properties. This compound is typically a white to off-white solid and is soluble in polar solvents, which is common for carboxylic acids. It may exhibit acidic behavior due to the carboxylic acid group, allowing it to participate in various chemical reactions, such as esterification or amidation. Additionally, 1-Methyl-1H-indazole-6-carboxylic acid may have potential applications in pharmaceuticals or as a building block in organic synthesis, owing to the reactivity of both the indazole moiety and the carboxylic acid. Its specific biological activities and interactions would depend on further studies and context within medicinal chemistry.
Formula:C9H8N2O2
InChI:InChI=1S/C9H8N2O2/c1-11-8-4-6(9(12)13)2-3-7(8)5-10-11/h2-5H,1H3,(H,12,13)
InChI key:InChIKey=DNMTXRJELGPOGW-UHFFFAOYSA-N
SMILES:CN1C=2C(=CC=C(C(O)=O)C2)C=N1
Synonyms:
  • 1H-Indazole-6-carboxylic acid, 1-methyl-
  • 1-Methyl-1H-indazole-6-carboxylic acid
  • 1-Methylindazole-6-carboxylic acid
Found 4 products.