CAS 1031417-88-5

1,3-Dimethyl-1H-indazole-6-carboxylic acid

Description:

1,3-Dimethyl-1H-indazole-6-carboxylic acid is a chemical compound characterized by its indazole core, which is a five-membered aromatic ring containing two nitrogen atoms. This compound features two methyl groups attached to the first and third positions of the indazole ring, contributing to its dimethyl designation. The presence of a carboxylic acid functional group at the sixth position imparts acidic properties to the molecule, making it capable of participating in various chemical reactions, such as esterification and amidation. The compound is typically used in research and development, particularly in medicinal chemistry, due to its potential biological activities. Its solubility and stability can vary depending on the solvent and environmental conditions. Additionally, the structural characteristics of 1,3-Dimethyl-1H-indazole-6-carboxylic acid may influence its interactions with biological targets, making it a subject of interest for further studies in pharmacology and drug design. Safety data and handling precautions should be observed, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₁₀H₁₀N₂O₂

InChI: InChI=1S/C10H10N2O2/c1-6-8-4-3-7(10(13)14)5-9(8)12(2)11-6/h3-5H,1-2H3,(H,13,14)

InChI key: InChIKey=CPLFRBGIKHNEKO-UHFFFAOYSA-N

SMILES: CN1C=2C(C(C)=N1)=CC=C(C(O)=O)C2

Synonyms:

• 1,3-Dimethyl-1H-indazole-6-carboxylic acid
• 1H-Indazole-6-carboxylic acid, 1,3-dimethyl-