CAS 103151-23-1
:α,α-Dimethyl-3-nitrobenzeneacetamide
Description:
α,α-Dimethyl-3-nitrobenzeneacetamide, with the CAS number 103151-23-1, is an organic compound characterized by its aromatic structure and functional groups. It features a nitro group (-NO2) attached to a benzene ring, which contributes to its reactivity and potential applications in various chemical reactions. The presence of the acetamide group (-C(=O)NH2) indicates that it can participate in amide bond formation and may exhibit properties typical of amides, such as hydrogen bonding capabilities. The two methyl groups attached to the alpha position of the acetamide enhance its steric bulk, potentially influencing its solubility and reactivity. This compound may be of interest in synthetic organic chemistry, particularly in the development of pharmaceuticals or agrochemicals, due to its unique structural features. Safety and handling precautions should be observed, as compounds containing nitro groups can be sensitive and may pose health risks. Overall, α,α-Dimethyl-3-nitrobenzeneacetamide is a notable compound for its structural characteristics and potential applications in various fields of chemistry.
Formula:C10H12N2O3
InChI:InChI=1S/C10H12N2O3/c1-10(2,9(11)13)7-4-3-5-8(6-7)12(14)15/h3-6H,1-2H3,(H2,11,13)
InChI key:InChIKey=KUNWLVWLBVXLTQ-UHFFFAOYSA-N
SMILES:C(C(N)=O)(C)(C)C1=CC(N(=O)=O)=CC=C1
Synonyms:- α,α-Dimethyl-3-nitrobenzeneacetamide
- Hydratropamide, α-methyl-m-nitro-
- 2-Methyl-2-(3-nitrophenyl)propanamide
- Benzeneacetamide, α,α-dimethyl-3-nitro-
- 2-Methyl-2-(3-nitrophenyl)propionamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
