CAS 1031793-23-3

1H-Pyrazol-3-amine, 5-(2,3-dihydro-1,4-benzodioxin-6-yl)-, hydrochloride (1:1)

Description:

1H-Pyrazol-3-amine, 5-(2,3-dihydro-1,4-benzodioxin-6-yl)-, hydrochloride (1:1) is a chemical compound characterized by its pyrazole and benzodioxin moieties, which contribute to its potential biological activity. The presence of the pyrazole ring suggests that it may exhibit properties typical of heterocyclic compounds, including potential reactivity and interaction with biological targets. The hydrochloride form indicates that the compound is a salt, which often enhances solubility in aqueous solutions, making it suitable for various applications, including pharmaceutical formulations. The compound's structure may allow for interactions with specific receptors or enzymes, potentially leading to therapeutic effects. Additionally, the dihydro-benzodioxin component may impart unique chemical properties, such as stability and the ability to participate in further chemical reactions. Overall, this compound's characteristics suggest it may be of interest in medicinal chemistry and drug development, although specific biological activities and mechanisms would require further investigation through experimental studies.

Formula: C₁₁H₁₁N₃O₂·ClH

InChI: InChI=1S/C11H11N3O2.ClH/c12-11-6-8(13-14-11)7-1-2-9-10(5-7)16-4-3-15-9;/h1-2,5-6H,3-4H2,(H3,12,13,14);1H

InChI key: InChIKey=AWEHTVAKWAPSBW-UHFFFAOYSA-N

SMILES: NC=1C=C(C=2C=C3C(=CC2)OCCO3)NN1.Cl

Synonyms:

• 1H-Pyrazol-3-amine, 5-(2,3-dihydro-1,4-benzodioxin-6-yl)-, hydrochloride (1:1)