CAS 10318-01-1

(2Z,4E)-2-fluorohexa-2,4-dienedioic acid

Description:

(2Z,4E)-2-fluorohexa-2,4-dienedioic acid is an organic compound characterized by its unique structure, which includes a six-carbon chain with two double bonds and a fluorine substituent. The designation "(2Z,4E)" indicates the specific geometric configurations of the double bonds, with the "Z" configuration at the second carbon and the "E" configuration at the fourth carbon. This compound features two carboxylic acid functional groups (-COOH), which contribute to its acidity and reactivity. The presence of the fluorine atom enhances its polarity and can influence its chemical behavior, making it potentially useful in various synthetic applications. The compound is likely to be a colorless or pale yellow liquid or solid, depending on its state at room temperature. Its solubility in polar solvents, such as water, is expected due to the carboxylic acid groups. Overall, (2Z,4E)-2-fluorohexa-2,4-dienedioic acid is of interest in organic synthesis and may have applications in pharmaceuticals or agrochemicals due to its unique structural features.

Formula: C₆H₅FO₄

InChI: InChI=1/C6H5FO4/c7-4(6(10)11)2-1-3-5(8)9/h1-3H,(H,8,9)(H,10,11)/b3-1+,4-2-