CAS 103181-68-6
:2-[(2-Methoxyphenoxy)methyl]thiazolidine
Description:
2-[(2-Methoxyphenoxy)methyl]thiazolidine, identified by its CAS number 103181-68-6, is a chemical compound characterized by its thiazolidine ring structure, which is a five-membered heterocyclic compound containing both sulfur and nitrogen. This compound features a methoxyphenoxy group, indicating the presence of a methoxy group (-OCH3) attached to a phenyl ring, which is further linked to a thiazolidine moiety through a methylene bridge. The thiazolidine structure contributes to its potential biological activity, as compounds in this class are often investigated for their pharmacological properties. The presence of the methoxyphenoxy group may enhance lipophilicity and influence the compound's interaction with biological targets. Additionally, the compound's solubility, stability, and reactivity can be affected by the functional groups present, making it of interest in medicinal chemistry and drug development. Overall, 2-[(2-Methoxyphenoxy)methyl]thiazolidine represents a unique structure that may exhibit diverse chemical and biological properties.
Formula:C11H15NO2S
InChI:InChI=1S/C11H15NO2S/c1-13-9-4-2-3-5-10(9)14-8-11-12-6-7-15-11/h2-5,11-12H,6-8H2,1H3
InChI key:InChIKey=RVDKSQDMEIWCNB-UHFFFAOYSA-N
SMILES:O(CC1NCCS1)C2=C(OC)C=CC=C2
Synonyms:- Thiazolidine, 2-[(2-methoxyphenoxy)methyl]-
- 2-[(2-Methoxyphenoxy)methyl]-1,3-thiazolidine
- 2-[(2-Methoxyphenoxy)methyl]thiazolidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
