CAS 103181-72-2
:Guaisteine
Description:
Guaisteine, with the CAS number 103181-72-2, is a chemical compound that belongs to the class of guanidine derivatives. It is characterized by its potential use in various pharmaceutical applications, particularly in the field of respiratory health. Guaisteine is known for its mucolytic properties, which means it can help break down mucus in the airways, making it easier to expel. This characteristic makes it valuable in treating conditions such as chronic obstructive pulmonary disease (COPD) and other respiratory disorders. The compound typically exhibits good solubility in water, which is advantageous for its formulation in liquid medications. Additionally, guaisteine may possess antioxidant properties, contributing to its therapeutic effects. As with many chemical substances, its safety profile and potential side effects are important considerations in its use, necessitating further research and clinical evaluation to fully understand its efficacy and safety in medical applications.
Formula:C15H19NO4S2
InChI:InChI=1/C15H19NO4S2/c1-11(17)22-10-14(18)16-7-8-21-15(16)9-20-13-6-4-3-5-12(13)19-2/h3-6,15H,7-10H2,1-2H3
SMILES:CC(=O)SCC(=O)N1CCSC1COc1ccccc1OC
Synonyms:- (±)-2-((2-Methoxyphenoxy)methyl)-3-(2-(acetylthio)acetyl)-1,3-thiazolidine
- 103181-72-2
- ethanethioic acid, S-[2-[2-[(2-methoxyphenoxy)methyl]-3-thiazolidinyl]-2-oxoethyl] ester
- S-(2-{2-[(2-Methoxyphenoxy)methyl]-1,3-thiazolidin-3-yl}-2-oxoethyl) ethanethioate
- Thioacetic Acid S-Ester with (±)-3-(Mercaptoacetyl)-2-((o-methoxyphenoxy)methyl)thiazolidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.