CAS 103189-63-5
:3-Amino-butyric acid methyl ester
Description:
3-Amino-butyric acid methyl ester, also known as methyl 3-aminobutanoate, is an organic compound characterized by the presence of an amino group and a carboxylic acid ester functional group. It typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. This compound is soluble in polar solvents such as water and alcohols, which is indicative of its polar nature due to the amino and ester groups. The presence of the amino group allows it to participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it a valuable intermediate in organic synthesis. Additionally, it may exhibit biological activity, as derivatives of amino acids are often involved in metabolic processes. Its molecular structure contributes to its potential applications in pharmaceuticals, agrochemicals, and as a building block in the synthesis of more complex molecules. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C5H11NO2
InChI:InChI=1/C5H11NO2/c1-4(6)3-5(7)8-2/h4H,3,6H2,1-2H3/t4-/m1/s1
SMILES:C[C@H](CC(=O)OC)N
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-Amino-butyric acid methyl ester
CAS:Formula:C5H11NO2Purity:98%Color and Shape:LiquidMolecular weight:117.1463(R)-Methyl 3-aminobutanoate
CAS:Formula:C5H11NO2Purity:98%Color and Shape:LiquidMolecular weight:117.148(R)-3-Amino-butyric acid methyl ester
CAS:Please enquire for more information about (R)-3-Amino-butyric acid methyl ester including the price, delivery time and more detailed product information at the technical inquiry form on this page
Formula:C5H11NO2Purity:Min. 95%Molecular weight:117.15 g/mol




