CAS 10319-80-9

N-1-Naphthalenylethanethioamide

Description:

N-1-Naphthalenylethanethioamide, with the CAS number 10319-80-9, is an organic compound characterized by its naphthalene moiety attached to an ethanethioamide functional group. This compound typically exhibits a solid state at room temperature and is known for its aromatic properties due to the presence of the naphthalene ring, which contributes to its stability and potential interactions in various chemical environments. The thioamide functional group imparts unique reactivity, making it of interest in synthetic organic chemistry and potentially in medicinal chemistry for its biological activities. The compound may exhibit moderate solubility in organic solvents, while its solubility in water is generally limited due to the hydrophobic nature of the naphthalene structure. Additionally, N-1-Naphthalenylethanethioamide may participate in hydrogen bonding and other intermolecular interactions, influencing its physical properties and reactivity. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken during use.

Formula: C₁₂H₁₁NS

InChI: InChI=1S/C12H11NS/c1-9(14)13-12-8-4-6-10-5-2-3-7-11(10)12/h2-8H,1H3,(H,13,14)

InChI key: InChIKey=VCHHDIBIIGAJQB-UHFFFAOYSA-N

SMILES: N(C(C)=S)C=1C2=C(C=CC1)C=CC=C2

Synonyms:

• N-1-Naphthalenylethanethioamide
• Acetamide, N-1-naphthylthio-
• Ethanethioamide, N-1-naphthalenyl-
• 1-Thioacetamidonaphthalene
• N-(1-Naphthyl)thioacetamide