CAS 103192-53-6

Acetic acid, [(aminocarbonyl)amino]hydroxy-, monosodium salt

Description:

Acetic acid, [(aminocarbonyl)amino]hydroxy-, monosodium salt, commonly referred to as sodium N-(hydroxyacetyl)glycinate, is a chemical compound characterized by its structure, which includes an acetic acid moiety and an amino group. This compound is typically a white to off-white solid that is soluble in water, making it useful in various applications, particularly in the cosmetic and pharmaceutical industries. It exhibits properties such as being a mild acid and a buffering agent, which can help maintain pH stability in formulations. Additionally, it may possess antimicrobial properties, contributing to its use as a preservative. The presence of both amino and hydroxyl functional groups allows for potential interactions with biological systems, enhancing its utility in biochemistry and medicinal chemistry. Overall, this compound is valued for its multifunctional characteristics, making it a versatile ingredient in various formulations.

Formula: C₃H₆N₂O₄·Na

InChI: InChI=1S/C3H6N2O4.Na/c4-3(9)5-1(6)2(7)8;/h1,6H,(H,7,8)(H3,4,5,9);

InChI key: InChIKey=YXYKAASGHRMELH-UHFFFAOYSA-N

SMILES: C(NC(N)=O)(C(O)=O)O.[Na]

Synonyms:

• Acetic acid, [(aminocarbonyl)amino]hydroxy-, monosodium salt