CAS 1031927-11-3

1,1-Dimethylethyl 2-oxo-1,9-diazaspiro[5.5]undec-3-ene-9-carboxylate

Description:

1,1-Dimethylethyl 2-oxo-1,9-diazaspiro[5.5]undec-3-ene-9-carboxylate, with the CAS number 1031927-11-3, is a chemical compound characterized by its unique spirocyclic structure, which incorporates both nitrogen and carbon atoms. This compound features a diazaspiro framework, indicating the presence of two nitrogen atoms within a spirocyclic arrangement, contributing to its potential biological activity. The presence of a carboxylate group suggests that it may exhibit acidic properties, while the 2-oxo functional group indicates the presence of a carbonyl, which can participate in various chemical reactions, including nucleophilic additions. The dimethyl substituent on the nitrogen atom enhances steric hindrance, potentially influencing the compound's reactivity and interactions with biological targets. Overall, this compound may be of interest in medicinal chemistry and drug design due to its complex structure and the potential for diverse biological activities, although specific applications and properties would require further investigation through experimental studies.

Formula: C₁₄H₂₂N₂O₃

InChI: InChI=1S/C14H22N2O3/c1-13(2,3)19-12(18)16-9-7-14(8-10-16)6-4-5-11(17)15-14/h4-5H,6-10H2,1-3H3,(H,15,17)

InChI key: InChIKey=JBUOMDZZKABJBU-UHFFFAOYSA-N

SMILES: O=C1NC2(CCN(C(OC(C)(C)C)=O)CC2)CC=C1

Synonyms:

• 1,9-Diazaspiro[5.5]undec-3-ene-9-carboxylic acid, 2-oxo-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 2-oxo-1,9-diazaspiro[5.5]undec-3-ene-9-carboxylate

2-Oxo-1,9-diazaspiro[5.5]undec-3-ene, N9-BOC protected

CAS: 1031927-11-3

2-Oxo-1,9-diazaspiro[5.5]undec-3-ene, N9-BOC protected

Purity: 95%

Molecular weight: 266.34g/mol

Ref: 54-OR2324