
CAS 1031927-98-6
:2,6-Dichloro-3-ethyl-8-methylquinoline
Description:
2,6-Dichloro-3-ethyl-8-methylquinoline is an organic compound belonging to the quinoline family, characterized by a bicyclic structure that includes a benzene ring fused to a pyridine ring. This compound features two chlorine substituents at the 2 and 6 positions, an ethyl group at the 3 position, and a methyl group at the 8 position of the quinoline ring. The presence of chlorine atoms contributes to its potential reactivity and influences its physical properties, such as solubility and boiling point. Typically, compounds like this may exhibit biological activity, making them of interest in pharmaceutical research. The molecular structure suggests that it may participate in various chemical reactions, including electrophilic aromatic substitution due to the electron-withdrawing nature of the chlorine atoms. Additionally, the compound's specific arrangement of substituents can affect its interaction with biological targets, potentially leading to applications in medicinal chemistry. Safety data and handling precautions should be considered due to the presence of halogenated compounds, which can pose environmental and health risks.
Formula:C12H11Cl2N
InChI:InChI=1S/C12H11Cl2N/c1-3-8-5-9-6-10(13)4-7(2)11(9)15-12(8)14/h4-6H,3H2,1-2H3
InChI key:InChIKey=ZYRWSUAIIDHWBB-UHFFFAOYSA-N
SMILES:CC=1C2=C(C=C(CC)C(Cl)=N2)C=C(Cl)C1
Synonyms:- Quinoline, 2,6-dichloro-3-ethyl-8-methyl-
- 2,6-Dichloro-3-ethyl-8-methylquinoline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.