CAS 1031927-99-7

2,6-Dichloro-3-ethylquinoline

Description:

2,6-Dichloro-3-ethylquinoline is an organic compound belonging to the quinoline family, characterized by its bicyclic structure that includes a benzene ring fused to a pyridine ring. This compound features two chlorine atoms at the 2 and 6 positions and an ethyl group at the 3 position of the quinoline ring. It is typically a yellow to brown solid at room temperature and is sparingly soluble in water but more soluble in organic solvents such as ethanol and acetone. The presence of chlorine substituents can influence its reactivity and potential applications, including its use in pharmaceuticals, agrochemicals, and as a building block in organic synthesis. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling and exposure guidelines, as halogenated compounds can pose environmental and health risks. Overall, 2,6-Dichloro-3-ethylquinoline is a notable compound in the field of organic chemistry with diverse potential applications.

Formula: C₁₁H₉Cl₂N

InChI: InChI=1S/C11H9Cl2N/c1-2-7-5-8-6-9(12)3-4-10(8)14-11(7)13/h3-6H,2H2,1H3

InChI key: InChIKey=TXFBXNIYHNTZSB-UHFFFAOYSA-N

SMILES: C(C)C1=CC2=C(N=C1Cl)C=CC(Cl)=C2

Synonyms:

• Quinoline, 2,6-dichloro-3-ethyl-
• 2,6-Dichloro-3-ethylquinoline