CymitQuimica logo

CAS 1031929-20-0

:

4-Fluoro-2-iodobenzonitrile

Description:
4-Fluoro-2-iodobenzonitrile is an organic compound characterized by the presence of both fluorine and iodine substituents on a benzene ring, along with a nitrile functional group. The molecular structure consists of a benzene ring with a cyano group (-C≡N) and halogen atoms at the 2 and 4 positions, making it a member of the halogenated aromatic nitriles. This compound typically exhibits a crystalline solid form and is soluble in organic solvents. Its unique combination of halogen atoms can impart distinct reactivity, making it useful in various chemical syntheses and applications, including pharmaceuticals and agrochemicals. The presence of the nitrile group contributes to its polarity and potential for hydrogen bonding, influencing its physical properties such as boiling and melting points. Additionally, the compound may exhibit interesting electronic properties due to the electron-withdrawing effects of the halogens, which can affect its reactivity in electrophilic aromatic substitution reactions. Safety data should be consulted for handling and storage, as halogenated compounds can pose health and environmental risks.
Formula:C7H3FIN
InChI:InChI=1S/C7H3FIN/c8-6-2-1-5(4-10)7(9)3-6/h1-3H
InChI key:RGCHISPSDYWBMX-UHFFFAOYSA-N
SMILES:C1=CC(=C(C=C1F)I)C#N
Synonyms:
  • 2-Iodo-4-fluorobenzonitrile
  • Benzonitrile, 4-fluoro-2-iodo-
Found 4 products.