CAS 103199-83-3
:1-Butyl-4-methylpiperidine
Description:
1-Butyl-4-methylpiperidine is a chemical compound characterized by its piperidine ring structure, which consists of a six-membered ring containing five carbon atoms and one nitrogen atom. The compound features a butyl group and a methyl group attached to the piperidine ring, specifically at the 1 and 4 positions, respectively. This substitution pattern contributes to its unique properties, including its potential as a solvent or intermediate in organic synthesis. It is typically a colorless to pale yellow liquid with a distinctive amine-like odor. The presence of the nitrogen atom in the ring imparts basicity to the compound, allowing it to participate in various chemical reactions, such as nucleophilic substitutions. Additionally, 1-butyl-4-methylpiperidine may exhibit moderate solubility in organic solvents and limited solubility in water, which is common for amine-containing compounds. Safety data should be consulted for handling and storage, as it may pose health risks if inhaled or ingested.
Formula:C10H21N
InChI:InChI=1S/C10H21N/c1-3-4-7-11-8-5-10(2)6-9-11/h10H,3-9H2,1-2H3
InChI key:InChIKey=AXMCYIWXDKWDCL-UHFFFAOYSA-N
SMILES:C(CCC)N1CCC(C)CC1
Synonyms:- Piperidine, 1-butyl-4-methyl-
- 1-Butyl-4-methylpiperidine
- 1-(n-Butyl)-4-methylpiperidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
