CAS 103204-69-9
:4-(Acetylamino)-2-methylbenzoic acid
Description:
4-(Acetylamino)-2-methylbenzoic acid, also known by its CAS number 103204-69-9, is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with both an acetylamino group and a methyl group. This compound typically appears as a solid and is soluble in polar solvents due to the presence of the carboxylic acid functional group. The acetylamino group contributes to its potential as a pharmaceutical intermediate, as it can participate in various chemical reactions, including acylation and amidation. The presence of the methyl group influences its steric properties and can affect its biological activity. Additionally, the compound may exhibit specific melting and boiling points, as well as distinct spectral characteristics in techniques such as NMR and IR spectroscopy, which can be used for its identification and characterization. Overall, 4-(Acetylamino)-2-methylbenzoic acid is of interest in organic synthesis and medicinal chemistry due to its functional groups and structural features.
Formula:C10H11NO3
InChI:InChI=1S/C10H11NO3/c1-6-5-8(11-7(2)12)3-4-9(6)10(13)14/h3-5H,1-2H3,(H,11,12)(H,13,14)
InChI key:InChIKey=AQPDTYYKDYMCTH-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C)C=C(NC(C)=O)C=C1
Synonyms:- 4-(Acetylamino)-2-Methylbenzoic Acid
- Benzoic acid, 4-(acetylamino)-2-methyl-
- Rarechem Al Bo 1473
- o-Toluic acid, 4-acetamido-
- o-Toluic acid, 4-acetamido- (6CI)
- 4-Acetamido-2-methylbenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
4-Acetamido-2-methylbenzoic Acid
CAS:Formula:C10H11NO3Purity:>96.0%(T)(HPLC)Color and Shape:White to Yellow powder to crystalMolecular weight:193.204-Acetamido-2-methylbenzoic acid, 96%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C10H11NO3Purity:96%Color and Shape:Pale yellow to yellow, PowderMolecular weight:193.204-Acetamido-2-methylbenzoic acid
CAS:Formula:C10H11NO3Purity:97%Color and Shape:SolidMolecular weight:193.19924-Acetamido-2-methylbenzoic acid
CAS:4-Acetamido-2-methylbenzoic acidPurity:≥95%Color and Shape:Pale Yellow PowderMolecular weight:193.20g/mol4-Acetamido-2-methylbenzoic acid
CAS:4-Acetamido-2-methylbenzoic acid is a chemical that can be used as a building block in the production of other chemicals, such as pharmaceuticals and pesticides. It has been shown to be useful in research for its ability to serve as a reagent, intermediate, or scaffold for synthesizing more complex compounds. 4-Acetamido-2-methylbenzoic acid is also known by CAS No. 103204-69-9.Formula:C10H11NO3Purity:Min. 95%Color and Shape:PowderMolecular weight:193.2 g/mol






