CAS 103204-90-6

2-methyl-4-oxo-6,7-dihydro-5H-benzofuran-3-carboxylic acid

Description:

2-Methyl-4-oxo-6,7-dihydro-5H-benzofuran-3-carboxylic acid, with the CAS number 103204-90-6, is a chemical compound that belongs to the class of benzofuran derivatives. This substance features a fused benzofuran ring system, which contributes to its unique structural and chemical properties. The presence of a carboxylic acid functional group indicates that it can participate in acid-base reactions and may exhibit solubility in polar solvents. The ketone group (4-oxo) suggests potential reactivity in nucleophilic addition reactions. Additionally, the methyl group at the 2-position can influence the compound's steric and electronic properties, potentially affecting its reactivity and interactions with biological systems. This compound may have applications in medicinal chemistry or as an intermediate in organic synthesis, although specific biological activities or uses would require further investigation. Overall, its structural features suggest it could exhibit interesting chemical behavior, making it a subject of interest in various fields of research.

Formula: C₁₀H₁₀O₄

InChI: InChI=1/C10H10O4/c1-5-8(10(12)13)9-6(11)3-2-4-7(9)14-5/h2-4H2,1H3,(H,12,13)

SMILES: Cc1c(c2C(=O)CCCc2o1)C(=O)O