CAS 1032056-94-2

1-[(2-Methylcyclopropyl)carbonyl]-2-piperidinecarboxylic acid

Description:

1-[(2-Methylcyclopropyl)carbonyl]-2-piperidinecarboxylic acid is a chemical compound characterized by its unique structure, which includes a piperidine ring and a cyclopropyl group. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of the 2-methylcyclopropyl moiety introduces steric hindrance, which can influence its reactivity and interactions with biological targets. The piperidine ring is a six-membered nitrogen-containing heterocycle, known for its role in various pharmacological activities. This compound may exhibit potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can interact with biological systems. Additionally, the specific arrangement of functional groups can affect its solubility, stability, and overall bioactivity. As with many organic compounds, its synthesis and characterization would involve standard techniques such as NMR spectroscopy, mass spectrometry, and chromatography to confirm its identity and purity.

Formula: C₁₁H₁₇NO₃

InChI: InChI=1S/C11H17NO3/c1-7-6-8(7)10(13)12-5-3-2-4-9(12)11(14)15/h7-9H,2-6H2,1H3,(H,14,15)

InChI key: InChIKey=PGKUSBLIDFWNGG-UHFFFAOYSA-N

SMILES: C(=O)(N1C(C(O)=O)CCCC1)C2C(C)C2

Synonyms:

• 1-[(2-Methylcyclopropyl)carbonyl]-2-piperidinecarboxylic acid
• 2-Piperidinecarboxylic acid, 1-[(2-methylcyclopropyl)carbonyl]-

1-(2-Methylcyclopropanecarbonyl)piperidine-2-carboxylic acid

CAS: 1032056-94-2

Versatile small molecule scaffold

Formula: C₁₁H₁₇NO₃

Purity: Min. 95%

Molecular weight: 211.26 g/mol

Ref: 3D-HRB05694