CAS 103213-31-6: fmoc-3,5-diiodo-L-tyrosine
Description:Fmoc-3,5-diiodo-L-tyrosine is a derivative of the amino acid tyrosine, characterized by the presence of two iodine atoms at the 3 and 5 positions of the aromatic ring, which significantly influences its chemical properties and reactivity. The "Fmoc" (9-fluorenylmethoxycarbonyl) group is a protective group commonly used in peptide synthesis, providing stability and facilitating the selective deprotection of the amino group during the synthesis process. This compound is typically utilized in the field of organic chemistry and biochemistry, particularly in the synthesis of peptides and proteins where specific modifications are required. The introduction of iodine atoms enhances the compound's hydrophobicity and can affect its biological activity, making it of interest in medicinal chemistry. Additionally, the presence of the Fmoc group allows for compatibility with various coupling reactions, making it a versatile building block in the synthesis of complex biomolecules. Overall, Fmoc-3,5-diiodo-L-tyrosine serves as an important tool in the development of novel therapeutic agents and research applications.
Formula:C24H19I2NO5
InChI:InChI=1/C24H19I2NO5/c25-19-9-13(10-20(26)22(19)28)11-21(23(29)30)27-24(31)32-12-18-16-7-3-1-5-14(16)15-6-2-4-8-17(15)18/h1-10,18,21,28H,11-12H2,(H,27,31)(H,29,30)/t21-/m0/s1
- Synonyms:
- Fmoc-3,5-diiodo-Tyr-OH
- Fmoc-Tyr(3,5-I2)-OH
- Fmoc-Tyr(3,5-di-I)-OH
- N-[(9H-fluoren-9-ylmethoxy)carbonyl]-3,5-diiodo-L-tyrosine
- Fmoc-Tyr(3,5-DiI)-OH
![discount label](https://static.cymitquimica.com/public/img/discount.png)
L-Tyrosine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-3,5-diiodo-
Ref: IN-DA00HA01
1g | 36.00 € | ||
5g | 94.00 € | ||
10g | 152.00 € | ||
25g | 268.00 € | ||
100g | To inquire | ||
250mg | 34.00 € |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
Ref: 10-F808462
5g | 72.00 € | ||
10g | 129.00 € | ||
25g | 295.00 € |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
Fmoc-3,5-diiodo-L-tyrosine
Ref: 3D-FF47366
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
500mg | Discontinued | Request information |