CAS 103213-51-0

1,N6-ethenoadenosine 3':5'-cyclic*monophosphate S

Description:

1,N6-Ethenoadenosine 3',5'-cyclic monophosphate S, commonly referred to as etheno-cAMP, is a modified nucleotide derivative of cyclic adenosine monophosphate (cAMP). This compound features an etheno modification at the N6 position of the adenine base, which alters its biochemical properties compared to standard cAMP. Etheno-cAMP is known for its increased stability and resistance to hydrolysis, making it a useful tool in biochemical research, particularly in studies involving cyclic nucleotide signaling pathways. The cyclic monophosphate structure allows it to participate in various cellular signaling processes, mimicking the action of natural cAMP while providing unique insights into receptor interactions and enzyme activities. Its S configuration indicates a specific stereochemistry that can influence its biological activity. Researchers often utilize etheno-cAMP to investigate the roles of cyclic nucleotides in cellular processes, including signal transduction, gene expression, and metabolic regulation. Overall, this compound serves as an important analog in the study of nucleotide signaling mechanisms.

Formula: C₁₂H₁₂N₅NaO₆P

InChI: InChI=1/C12H12N5O6P.Na/c18-3-6-8-9(23-24(19,20)22-8)12(21-6)17-5-14-7-10-13-1-2-16(10)4-15-11(7)17;/h1-2,4-6,8-9,12,18H,3H2,(H,19,20);

SMILES: c1cn2cnc3c(c2n1)ncn3C1C2C(C(CO)O1)OP(=O)(O)O2.[Na]

Synonyms:

• furo[3,4-d]-1,3,2-dioxaphosphole-4-methanol, tetrahydro-2-hydroxy-6-(3H-imidazo[2,1-i]purin-3-yl)-, 2-oxide, monosodium salt

1,N6-Ethenoadenosine 3′:5′-cyclic monophosphate sodium salt

CAS: 103213-51-0

Formula: C₁₂H₁₁N₅O₆PNa

Molecular weight: 375.21

Ref: 7W-GK5985