CAS 103213-60-1
:erucic anhydride
Description:
Erucic anhydride, with the CAS number 103213-60-1, is a chemical compound derived from erucic acid, a long-chain monounsaturated fatty acid. It is characterized by its anhydride form, which typically indicates the presence of a cyclic structure formed by the dehydration of carboxylic acid groups. This substance is a colorless to pale yellow liquid, exhibiting a relatively high boiling point and low volatility. Erucic anhydride is known for its applications in the production of lubricants, surfactants, and as an intermediate in organic synthesis. It possesses properties such as good thermal stability and resistance to oxidation, making it suitable for various industrial applications. Additionally, it is important to note that erucic acid and its derivatives have been studied for their potential health effects, particularly in relation to cardiovascular health, leading to regulatory scrutiny in some regions. Overall, erucic anhydride is a versatile compound with significant industrial relevance, particularly in the fields of chemistry and materials science.
Formula:C44H82O3
InChI:InChI=1/C44H82O3/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-39-41-43(45)47-44(46)42-40-38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20H,3-16,21-42H2,1-2H3/b19-17-,20-18-
SMILES:CCCCCCCC/C=C\CCCCCCCCCCCC(=O)OC(=O)CCCCCCCCCCC/C=C\CCCCCCCC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
