CymitQuimica logo

CAS 1032157-06-4

:

Benzenemethanamine, α-ethyl-2,5-dimethyl-, hydrochloride (1:1), (αR)-

Description:
Benzenemethanamine, α-ethyl-2,5-dimethyl-, hydrochloride (1:1), (αR)-, is a chemical compound characterized by its amine functional group and a substituted benzene ring. This compound features an ethyl group and two methyl groups on the benzene ring, contributing to its unique structural properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in various applications, particularly in pharmaceuticals. The (αR)- designation indicates the specific stereochemistry of the compound, which can influence its biological activity and interaction with receptors. This compound may exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can affect its reactivity and solubility. Its potential applications could span from medicinal chemistry to materials science, depending on its specific interactions and properties. As with all chemical substances, safety data and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C11H17N·ClH
InChI:InChI=1S/C11H17N.ClH/c1-4-11(12)10-7-8(2)5-6-9(10)3;/h5-7,11H,4,12H2,1-3H3;1H/t11-;/m1./s1
InChI key:InChIKey=KJIOSXQZANUDNX-RFVHGSKJSA-N
SMILES:[C@H](CC)(N)C1=C(C)C=CC(C)=C1.Cl
Synonyms:
  • Benzenemethanamine, α-ethyl-2,5-dimethyl-, hydrochloride (1:1), (αR)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.