CAS 1032182-14-1
:N-[[(5S)-3-[3-Fluoro-4-(4-morpholinyl-2,2,3,3,5,5,6,6-d8)phenyl]-2-oxo-5-oxazolidinyl]methyl]acetamide
Description:
N-[[(5S)-3-[3-Fluoro-4-(4-morpholinyl-2,2,3,3,5,5,6,6-d8)phenyl]-2-oxo-5-oxazolidinyl]methyl]acetamide, with CAS number 1032182-14-1, is a synthetic organic compound characterized by its complex structure, which includes an oxazolidinone ring and a morpholine moiety. This compound features a fluorinated phenyl group, contributing to its potential biological activity. The presence of the oxazolidinone structure suggests that it may exhibit antibiotic properties, as oxazolidinones are known for their role in inhibiting bacterial protein synthesis. The specific stereochemistry indicated by the (5S) designation is crucial for its biological activity, as stereoisomers can have significantly different effects in biological systems. Additionally, the incorporation of deuterated morpholine may enhance the compound's stability and alter its pharmacokinetic properties. Overall, this compound's unique structural features make it a subject of interest in medicinal chemistry, particularly in the development of new therapeutic agents.
Formula:C16H12D8FN3O4
InChI:InChI=1S/C16H20FN3O4/c1-11(21)18-9-13-10-20(16(22)24-13)12-2-3-15(14(17)8-12)19-4-6-23-7-5-19/h2-3,8,13H,4-7,9-10H2,1H3,(H,18,21)/t13-/m0/s1/i4D2,5D2,6D2,7D2
InChI key:InChIKey=TYZROVQLWOKYKF-LSSZDJLLSA-N
SMILES:O=C1N(C[C@H](CNC(C)=O)O1)C2=CC(F)=C(C=C2)N3C(C(OC(C3([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H]
Synonyms:- Acetamide, N-[[(5S)-3-[3-fluoro-4-(4-morpholinyl-2,2,3,3,5,5,6,6-d8)phenyl]-2-oxo-5-oxazolidinyl]methyl]-
- N-[[(5S)-3-[3-Fluoro-4-(4-morpholinyl-2,2,3,3,5,5,6,6-d8)phenyl]-2-oxo-5-oxazolidinyl]methyl]acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
