CymitQuimica logo

CAS 10322-25-5

:

2,3-diphenylbenzo[f]quinoxaline

Description:
2,3-Diphenylbenzo[f]quinoxaline is an organic compound characterized by its fused ring structure, which includes a quinoxaline moiety and two phenyl groups. It typically appears as a solid at room temperature and is known for its potential applications in organic electronics, particularly in light-emitting diodes and photonic devices due to its luminescent properties. The compound exhibits a relatively high thermal stability, making it suitable for various chemical processes. Its molecular structure contributes to its unique electronic properties, which can be influenced by substituents on the phenyl rings. Additionally, 2,3-diphenylbenzo[f]quinoxaline may exhibit fluorescence, which is of interest in the development of fluorescent probes and sensors. The compound is generally soluble in organic solvents, but its solubility can vary depending on the solvent used. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices are followed.
Formula:C24H16N2
InChI:InChI=1/C24H16N2/c1-3-10-18(11-4-1)22-23(19-12-5-2-6-13-19)26-24-20-14-8-7-9-17(20)15-16-21(24)25-22/h1-16H
SMILES:c1ccc(cc1)c1c(c2ccccc2)nc2c3ccccc3ccc2n1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.