CAS 1032231-30-3: B-(5-Bromo-2-cyanophenyl)boronic acid
Description:B-(5-Bromo-2-cyanophenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is substituted with a bromine atom and a cyano group. This compound typically exhibits properties such as being a white to off-white solid, soluble in polar organic solvents, and having moderate stability under standard conditions. The boronic acid moiety allows for participation in Suzuki coupling reactions, making it valuable in organic synthesis, particularly in the formation of carbon-carbon bonds. The presence of the bromine and cyano substituents can influence its reactivity and solubility, as well as its potential applications in medicinal chemistry and materials science. Additionally, the compound may exhibit interesting electronic properties due to the electron-withdrawing nature of the cyano group and the electron-donating characteristics of the boronic acid, which can be leveraged in various chemical applications. Overall, B-(5-Bromo-2-cyanophenyl)boronic acid is a versatile building block in synthetic organic chemistry.
Formula:C7H5BBrNO2
InChI:InChI=1S/C7H5BBrNO2/c9-6-2-1-5(4-10)7(3-6)8(11)12/h1-3,11-12H
InChI key:InChIKey=BVCIFFSGTUEHOP-UHFFFAOYSA-N
SMILES:N#CC1=CC=C(Br)C=C1B(O)O
- Synonyms:
- B-(5-Bromo-2-cyanophenyl)boronic acid
- 3-Bromo-6-cyanophenylboronic acid
- (5-Bromo-2-cyanophenyl)boronic acid
- Boronic acid, B-(5-bromo-2-cyanophenyl)-
- (5-Bromo-2-cyanophenyl)boronicacid
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 5-Bromo-2-cyanophenylboronic acid REF: IN-DA008SU7CAS: 1032231-30-3 | 94% | 26.00 €~556.00 € | Thu 17 Apr 25 |
![]() | (5-Bromo-2-cyanophenyl)boronic acid REF: 10-F231136CAS: 1032231-30-3 | 95.0% | 43.00 €~190.00 € | Tue 22 Apr 25 |
![]() | 5-Bromo-2-cyanophenylboronic acid REF: 54-OR360182CAS: 1032231-30-3 | - - - | 62.00 €~248.00 € | Thu 24 Apr 25 |
![]() | 5-Bromo-2-cyanophenylboronic acid REF: 3D-FB159903CAS: 1032231-30-3 | Min. 95% | - - - | Discontinued product |

5-Bromo-2-cyanophenylboronic acid
Ref: IN-DA008SU7
1g | 82.00 € | ||
5g | 205.00 € | ||
100mg | 26.00 € | ||
250mg | 43.00 € |

(5-Bromo-2-cyanophenyl)boronic acid
Ref: 10-F231136
1g | 43.00 € | ||
5g | 190.00 € |

Ref: 54-OR360182
1g | 62.00 € | ||
5g | 248.00 € |

5-Bromo-2-cyanophenylboronic acid
Ref: 3D-FB159903
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
5g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |