CymitQuimica logo

CAS 10323-68-9

:

2-methoxybenzene-1,4-diamine dihydrochloride

Description:
2-Methoxybenzene-1,4-diamine dihydrochloride, also known as 4-amino-2-methoxyaniline dihydrochloride, is an organic compound characterized by the presence of an amino group and a methoxy group on a benzene ring. It is a dihydrochloride salt, indicating that it exists in a hydrated form with two hydrochloric acid molecules. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the amino groups, which can engage in hydrogen bonding. It is primarily used in the synthesis of dyes, pigments, and pharmaceuticals, owing to its reactivity and ability to undergo various chemical transformations. The presence of both amino and methoxy groups allows for diverse functionalization, making it a valuable intermediate in organic synthesis. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested, and appropriate personal protective equipment should be used.
Formula:C7H12Cl2N2O
InChI:InChI=1/C7H10N2O.2ClH/c1-10-7-4-5(8)2-3-6(7)9;;/h2-4H,8-9H2,1H3;2*1H
SMILES:COc1cc(ccc1N)N.Cl.Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.