CAS 103234-38-4

4-(4-methoxy-3,5-dimethylphenyl)-4-oxobutanoic acid

Description:

4-(4-Methoxy-3,5-dimethylphenyl)-4-oxobutanoic acid, with the CAS number 103234-38-4, is an organic compound characterized by its complex structure, which includes a butanoic acid moiety and a substituted aromatic ring. The presence of the methoxy group and two methyl groups on the aromatic ring contributes to its hydrophobic characteristics, while the carboxylic acid functional group imparts acidic properties. This compound is likely to exhibit moderate solubility in organic solvents and limited solubility in water due to its hydrophobic and hydrophilic regions. Its molecular structure suggests potential applications in pharmaceuticals or as an intermediate in organic synthesis. The compound may also exhibit biological activity, although specific biological properties would need to be investigated through empirical studies. Overall, its unique structural features make it a subject of interest in various chemical research fields, particularly in medicinal chemistry and materials science.

Formula: C₁₃H₁₆O₄

InChI: InChI=1/C13H16O4/c1-8-6-10(7-9(2)13(8)17-3)11(14)4-5-12(15)16/h6-7H,4-5H2,1-3H3,(H,15,16)

SMILES: Cc1cc(cc(C)c1OC)C(=O)CCC(=O)O