CAS 1032349-93-1: 8-[4-(1-Aminocyclobutyl)phenyl]-9-phenyl-1,2,4-triazolo[3,4-f][1,6]naphthyridin-3(2H)-one

Description:The chemical substance known as "8-[4-(1-Aminocyclobutyl)phenyl]-9-phenyl-1,2,4-triazolo[3,4-f][1,6]naphthyridin-3(2H)-one" with CAS number 1032349-93-1 is a complex organic compound characterized by its multi-ring structure, which includes a triazole and naphthyridine moiety. This compound features a phenyl group and an aminocyclobutyl substituent, contributing to its potential biological activity. The presence of the triazole ring suggests possible interactions with biological targets, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its structural complexity may influence its solubility, stability, and reactivity, which are critical factors in drug design. Additionally, the compound's unique functional groups may impart specific pharmacological properties, potentially affecting its mechanism of action and therapeutic applications. Overall, this substance exemplifies the intricate relationship between chemical structure and biological function, highlighting the importance of detailed characterization in the field of drug discovery.

Formula:C₂₅H₂₁N₅O

InChI:InChI=1S/C25H21N5O/c26-25(12-4-13-25)18-9-7-17(8-10-18)22-19(16-5-2-1-3-6-16)15-20-21(27-22)11-14-30-23(20)28-29-24(30)31/h1-3,5-11,14-15H,4,12-13,26H2,(H,29,31)

InChI key:InChIKey=ULDXWLCXEDXJGE-UHFFFAOYSA-N

SMILES:O=C1NN=C2C=3C=C(C=4C=CC=CC4)C(=NC3C=CN12)C=5C=CC(=CC5)C6(N)CCC6

Synonyms:
MEK 2206
MK 2206
8-[4-(1-Aminocyclobutyl)phenyl]-9-phenyl-1,2,4-triazolo[3,4-f][1,6]naphthyridin-3(2H)-one
1,2,4-Triazolo[3,4-f][1,6]naphthyridin-3(2H)-one, 8-[4-(1-aminocyclobutyl)phenyl]-9-phenyl-