CAS 103239-24-3

L-glutathione oxidized disodium salt

Description:

L-glutathione oxidized disodium salt, with the CAS number 103239-24-3, is a derivative of glutathione, a tripeptide composed of glutamine, cysteine, and glycine. In its oxidized form, glutathione exists as a dimer, known as glutathione disulfide (GSSG), which plays a crucial role in cellular redox balance and detoxification processes. The disodium salt form indicates that the compound has two sodium ions associated with it, enhancing its solubility in aqueous solutions. This compound is often utilized in biochemical research and pharmaceutical applications due to its antioxidant properties, which help protect cells from oxidative stress. Additionally, it is involved in various metabolic processes, including the synthesis of proteins and the regulation of cellular functions. L-glutathione oxidized disodium salt is typically stable under standard conditions but may degrade under extreme pH or temperature. Its applications extend to cosmetics, food preservation, and as a supplement in health products, highlighting its significance in both scientific and commercial fields.

Formula: C₂₀H₃₀N₆Na₂O₁₂S₂

InChI: InChI=1/C20H32N6O12S2.2Na/c21-9(19(35)36)1-3-13(27)25-11(17(33)23-5-15(29)30)7-39-40-8-12(18(34)24-6-16(31)32)26-14(28)4-2-10(22)20(37)38;;/h9-12H,1-8,21-22H2,(H,23,33)(H,24,34)(H,25,27)(H,26,28)(H,29,30)(H,31,32)(H,35,36)(H,37,38);;/q;2*+1/p-2/t9-,10-,11+,12+;;/m0../s1

SMILES: C(CC(=NC(CSSCC(C(=NCC(=O)O)O)N=C(CCC(C(=O)O)N)O)C(=NCC(=O)O)O)O)C(C(=O)O)N.[Na].[Na]

Synonyms:

• glutathione disodium oxidized form*cell culture T
• Glutathione Oxidized Form Disodium
• disodium (2S)-2-amino-5-({(1S)-1-[({(2S)-2-{[(4S)-4-amino-4-carboxybutanoyl]amino}-3-[(carboxylatomethyl)amino]-3-oxopropyl}disulfanyl)methyl]-2-[(carboxymethyl)amino]-2-oxoethyl}amino)-5-oxopentanoate (non-preferred name)

L-Glutathione oxidized disodium

Controlled Product

CAS: 103239-24-3

Formula: C₂₀H₂₈N₆O₁₂S₂·2H·2Na

Color and Shape: Neat

Molecular weight: 656.595

Ref: TR-L253560