
CAS 1032446-30-2
:1-[(3S)-1-(Phenylmethyl)-3-pyrrolidinyl]piperazine
Description:
1-[(3S)-1-(Phenylmethyl)-3-pyrrolidinyl]piperazine, identified by its CAS number 1032446-30-2, is a chemical compound that belongs to the class of piperazine derivatives. This substance features a piperazine ring, which is a six-membered heterocyclic compound containing two nitrogen atoms, and is substituted with a pyrrolidine moiety that has a phenylmethyl group. The presence of the stereocenter in the pyrrolidine ring indicates that the compound can exist in different stereoisomeric forms, with the (3S) configuration being significant for its biological activity. Generally, piperazine derivatives are known for their diverse pharmacological properties, including potential applications in the fields of psychiatry and neurology. The compound may exhibit interactions with various neurotransmitter systems, making it of interest for research into therapeutic agents. Its solubility, stability, and reactivity would depend on the specific conditions and the presence of functional groups, which can influence its behavior in biological systems and chemical reactions.
Formula:C15H23N3
InChI:InChI=1S/C15H23N3/c1-2-4-14(5-3-1)12-17-9-6-15(13-17)18-10-7-16-8-11-18/h1-5,15-16H,6-13H2/t15-/m0/s1
InChI key:InChIKey=QRCCCCZXXGZOGG-HNNXBMFYSA-N
SMILES:C(N1C[C@H](CC1)N2CCNCC2)C3=CC=CC=C3
Synonyms:- 1-[(3S)-1-(Phenylmethyl)-3-pyrrolidinyl]piperazine
- (S)-1-(1-Benzylpyrrolidin-3-yl)piperazine
- Piperazine, 1-[(3S)-1-(phenylmethyl)-3-pyrrolidinyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
