
CAS 1032451-77-6
:(2R)-1-(Methylsulfonyl)-2-propanamine
Description:
(2R)-1-(Methylsulfonyl)-2-propanamine, with CAS number 1032451-77-6, is an organic compound characterized by its chiral structure, which includes a propanamine backbone with a methylsulfonyl group attached. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in polar solvents. The presence of the methylsulfonyl group enhances its reactivity and may impart unique pharmacological properties, making it of interest in medicinal chemistry. The chiral nature of the compound suggests that it may exhibit stereoselectivity in biological systems, potentially leading to different biological activities depending on the enantiomer. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, (2R)-1-(Methylsulfonyl)-2-propanamine represents a class of compounds that may have applications in pharmaceuticals or agrochemicals, warranting further investigation into its biological effects and potential uses.
Formula:C4H11NO2S
InChI:InChI=1S/C4H11NO2S/c1-4(5)3-8(2,6)7/h4H,3,5H2,1-2H3/t4-/m1/s1
InChI key:InChIKey=NKJASCWYRCSSQE-SCSAIBSYSA-N
SMILES:C(S(C)(=O)=O)[C@@H](C)N
Synonyms:- (2R)-1-Methanesulfonylpropan-2-amine
- 2-Propanamine 1-(methylsulfonyl)-, (2R)-
- (2R)-1-Methylsulfonylpropan-2-amine
- (2R)-1-(Methylsulfonyl)-2-propanamine
- 2-Propanamine, 1-(methylsulfonyl)-, (2R)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.