CAS 1032507-21-3

4′-Fluoro-3,4,5-trimethoxy-1,1′-biphenyl

Description:

4′-Fluoro-3,4,5-trimethoxy-1,1′-biphenyl is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of three methoxy groups (-OCH₃) at the 3, 4, and 5 positions on one of the phenyl rings contributes to its unique electronic and steric properties, enhancing its solubility and reactivity. The fluorine atom at the para position (4′) introduces additional polarity and can influence the compound's interaction with biological systems or other chemical entities. This compound may exhibit interesting optical properties and potential applications in organic electronics, pharmaceuticals, or as a building block in synthetic chemistry. Its specific reactivity and stability can be influenced by the substituents' positions and electronic effects, making it a subject of interest in various fields of research, including medicinal chemistry and materials science. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or environmental impact.

Formula: C₁₅H₁₅FO₃

InChI: InChI=1S/C15H15FO3/c1-17-13-8-11(9-14(18-2)15(13)19-3)10-4-6-12(16)7-5-10/h4-9H,1-3H3

InChI key: InChIKey=VFRUQUMDJIEBKK-UHFFFAOYSA-N

SMILES: O(C)C=1C=C(C=C(OC)C1OC)C2=CC=C(F)C=C2

Synonyms:

• 4′-Fluoro-3,4,5-trimethoxy-1,1′-biphenyl
• 1,1′-Biphenyl, 4′-fluoro-3,4,5-trimethoxy-