CAS 103259-35-4

Ethyl 3-amino-1H-pyrazole-4-carboxylate

Description:

Ethyl 3-amino-1H-pyrazole-4-carboxylate is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features an amino group (-NH2) and a carboxylate group (-COOEt) attached to the pyrazole ring, contributing to its reactivity and potential applications in medicinal chemistry. It is typically a white to off-white solid and is soluble in polar organic solvents. The presence of the amino group allows for hydrogen bonding, which can enhance its interaction with biological targets. Ethyl 3-amino-1H-pyrazole-4-carboxylate is of interest in various fields, including pharmaceuticals, where it may serve as a building block for the synthesis of more complex molecules or as a potential therapeutic agent. Its CAS number, 103259-35-4, is a unique identifier that facilitates the search for information regarding its properties, safety data, and regulatory status. Overall, this compound exemplifies the diverse chemistry associated with pyrazole derivatives.

Formula: C₆H₉N₃O₂

InChI: InChI=1S/C6H9N3O2/c1-2-11-6(10)4-3-8-9-5(4)7/h3H,2H2,1H3,(H3,7,8,9)

InChI key: InChIKey=YPXGHKWOJXQLQU-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1C(N)=NNC1

Synonyms:

• Pyrazole-4-carboxylic acid, 3(or 5)-amino-, ethyl ester
• 1H-Pyrazole-4-carboxylic acid, 3-amino-, ethyl ester
• 3-Amino-4-carbethoxypyrazole
• Pyrazole-4-carboxylic acid, 3-amino-, ethyl ester
• Ethyl 3-aminopyrazole-4-carboxylate