CAS 103260-65-7
:4-Methoxyindole-2-carboxylic acid
Description:
4-Methoxyindole-2-carboxylic acid is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a methoxy group (-OCH3) at the 4-position and a carboxylic acid group (-COOH) at the 2-position contributes to its unique chemical properties. This compound is typically a white to off-white solid and is soluble in polar solvents, such as water and alcohols, due to the polar nature of the carboxylic acid functional group. It exhibits acidic behavior, capable of donating a proton in solution. The methoxy group can influence the compound's reactivity and solubility, making it a potential candidate for various chemical reactions, including esterification and amidation. Additionally, 4-Methoxyindole-2-carboxylic acid may exhibit biological activity, making it of interest in pharmaceutical research. Its structural features allow for potential interactions with biological targets, which could lead to applications in drug development or as a biochemical probe.
Formula:C10H9NO3
InChI:InChI=1/C10H9NO3/c1-14-9-4-2-3-7-6(9)5-8(11-7)10(12)13/h2-5,11H,1H3,(H,12,13)
SMILES:COc1cccc2c1cc(C(=O)O)[nH]2
Synonyms:- 4-methoxy-1H-indole-2-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Methoxyindole-2-carboxylic acid
CAS:Formula:C10H9NO3Purity:97%Color and Shape:SolidMolecular weight:191.18344-Methoxy-1H-indole-2-carboxylic acid
CAS:4-Methoxy-1H-indole-2-carboxylic acidFormula:C10H9NO3Purity:98%Color and Shape: yellow solidMolecular weight:191.18336g/mol4-Methoxy-indole-2-carboxylic acid
CAS:Formula:C10H9NO3Purity:97%Color and Shape:SolidMolecular weight:191.1864-Methoxyindole-2-carboxylic acid, 97+%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C10H9NO3Purity:97+%Color and Shape:SolidMolecular weight:191.19



