CAS 103262-35-7: 2,3-DIHYDRO-1-BENZOFURAN-5-YLMETHANOL

Description:2,3-Dihydro-1-benzofuran-5-ylmethanol is an organic compound characterized by its unique bicyclic structure, which combines a benzofuran moiety with a hydroxymethyl group. This compound features a fused benzene and furan ring, contributing to its aromatic properties and potential reactivity. The presence of the hydroxymethyl group enhances its solubility in polar solvents and may influence its biological activity. Typically, compounds of this nature can exhibit various pharmacological properties, making them of interest in medicinal chemistry. The molecular structure suggests potential for hydrogen bonding due to the hydroxyl group, which can affect its interactions with biological targets. Additionally, the compound may undergo various chemical reactions, such as oxidation or substitution, depending on the conditions. Its CAS number, 103262-35-7, allows for easy identification in chemical databases, facilitating research and application in various fields, including pharmaceuticals and organic synthesis. Overall, 2,3-dihydro-1-benzofuran-5-ylmethanol is a compound with intriguing structural features and potential applications.

Formula:C₉H₁₀O₂

InChI:InChI=1/C9H10O2/c10-6-7-1-2-9-8(5-7)3-4-11-9/h1-2,5,10H,3-4,6H2

Synonyms:
Buttpark 121\06-58
Rarechem Al Bd 0327
2,3-Dihydro-5-(hydroxymethyl)benzo[b]furan
(2,3-Dihydro-benzofuran-5-yl)-methanol
5-Hydroxymethyl-2,3-dihydrobenzo[b]furan

Found 4 products.

Product data	Purity	Price range	Estimated delivery
(2,3-Dihydrobenzofuran-5-yl)methanol REF: IN-DA007HMBCAS: 103262-35-7	96%	42.00 €~526.00 €	Mon 03 Mar 25
2,3-Dihydro-5-(hydroxymethyl)benzo[b]furan REF: 54-OR22994CAS: 103262-35-7	- - -	32.00 €~45.00 €	Tue 04 Mar 25
5-Hydroxymethyl-2,3-dihydrobenzo[b]furan REF: 10-F067747CAS: 103262-35-7	97.0%	152.00 €~1,040.00 €	Tue 04 Mar 25
5-Hydroxymethyl-2,3-dihydrobenzo[b]furan REF: 3D-DEA26235CAS: 103262-35-7	Min. 95%	To inquire	Mon 14 Apr 25