CAS 1032668-60-2: Ethyl 2-amino-5-chloro-3-methylbenzoate

Description:Ethyl 2-amino-5-chloro-3-methylbenzoate is an organic compound characterized by its aromatic structure, which includes a benzoate moiety substituted with an amino group, a chlorine atom, and a methyl group. The presence of the ethyl ester functional group contributes to its solubility in organic solvents. This compound typically exhibits moderate polarity due to the combination of hydrophobic aromatic and hydrophilic functional groups. Its molecular structure suggests potential biological activity, making it of interest in medicinal chemistry and pharmaceutical research. The amino group can participate in hydrogen bonding, influencing its reactivity and interaction with biological targets. Additionally, the chlorine substituent may enhance lipophilicity and affect the compound's pharmacokinetic properties. Ethyl 2-amino-5-chloro-3-methylbenzoate may also undergo various chemical reactions, such as nucleophilic substitutions or electrophilic aromatic substitutions, depending on the reaction conditions. Overall, its unique combination of functional groups and structural features makes it a compound of interest for further study in various chemical and biological applications.

Formula:C₁₀H₁₂ClNO₂

InChI:InChI=1S/C10H12ClNO2/c1-3-14-10(13)8-5-7(11)4-6(2)9(8)12/h4-5H,3,12H2,1-2H3

InChI key:InChIKey=INHQWSPQWGUYBT-UHFFFAOYSA-N

SMILES:O=C(OCC)C1=CC(Cl)=CC(=C1N)C

Synonyms:
Benzoic acid, 2-amino-5-chloro-3-methyl-, ethyl ester
Ethyl 2-amino-5-chloro-3-methylbenzoate

Found 3 products.

Product data	Purity	Price range	Estimated delivery
Ethyl 2-amino-5-chloro-3-methylbenzoate REF: 54-OR79802CAS: 1032668-60-2	0.95	269.00 €~1,898.00 €	Tue 04 Mar 25
Ethyl 2-amino-5-chloro-3-methylbenzoate REF: 10-F742060CAS: 1032668-60-2	98%	146.00 €~1,782.00 €	Thu 06 Mar 25
Ethyl 2-amino-5-chloro-3-methylbenzoate REF: 3D-HRB66860CAS: 1032668-60-2	Min. 95%	- - -	Discontinued product