
CAS 103275-23-6
:Benzeneethanamine, 2-bromo-4,5-dimethoxy-, hydrochloride (1:1)
Description:
Benzeneethanamine, 2-bromo-4,5-dimethoxy-, hydrochloride (1:1) is a chemical compound characterized by its amine functional group and the presence of bromine and methoxy substituents on the benzene ring. The compound features a benzeneethanamine backbone, indicating that it has an ethylamine structure attached to a benzene ring. The presence of two methoxy groups at the 4 and 5 positions enhances its solubility and reactivity, while the bromine atom at the 2 position introduces electrophilic characteristics, making it a potential candidate for further chemical reactions. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, which is advantageous for various applications in organic synthesis and pharmaceutical formulations. The compound's unique structure may confer specific biological activities, making it of interest in medicinal chemistry. However, safety and handling precautions should be observed due to the potential toxicity associated with amines and halogenated compounds.
Formula:C10H14BrNO2·ClH
InChI:InChI=1S/C10H14BrNO2.ClH/c1-13-9-5-7(3-4-12)8(11)6-10(9)14-2;/h5-6H,3-4,12H2,1-2H3;1H
InChI key:InChIKey=PKYAXDWIMSZDLC-UHFFFAOYSA-N
SMILES:O(C)C1=C(OC)C=C(Br)C(CCN)=C1.Cl
Synonyms:- 2-(2-Bromo-4,5-dimethoxyphenyl)ethan-1-amine hydrochloride
- Benzeneethanamine, 2-bromo-4,5-dimethoxy-, hydrochloride (1:1)
- Phenethylamine, 2-bromo-4,5-dimethoxy-, hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-(2-Bromo-4,5-dimethoxyphenyl)ethan-1-amine Hydrochloride
CAS:Controlled ProductApplications 2-(2-bromo-4,5-dimethoxyphenyl)ethan-1-amine hydrochloride (cas# 103275-23-6) is a useful research chemical.
Formula:C10H14NO2Br•HClColor and Shape:NeatMolecular weight:260.133646
