CymitQuimica logo

CAS 1032758-45-4

:

6-(Bromomethyl)-2-chloro-7-methyl-4-(4-morpholinyl)thieno[3,2-d]pyrimidine

Description:
6-(Bromomethyl)-2-chloro-7-methyl-4-(4-morpholinyl)thieno[3,2-d]pyrimidine is a heterocyclic compound characterized by its complex structure, which includes a thieno[3,2-d]pyrimidine core. This compound features a bromomethyl group and a chlorine atom, contributing to its reactivity and potential for further chemical modifications. The presence of a morpholine ring enhances its solubility and may influence its biological activity, making it of interest in medicinal chemistry. The thieno[3,2-d]pyrimidine framework is known for its applications in pharmaceuticals, particularly as a scaffold for developing kinase inhibitors and other therapeutic agents. The compound's molecular structure suggests it may exhibit specific interactions with biological targets, potentially leading to pharmacological effects. Additionally, the presence of halogen substituents can affect the compound's lipophilicity and metabolic stability. Overall, this substance represents a class of compounds that may have significant implications in drug discovery and development, warranting further investigation into its properties and potential applications.
Formula:C12H13BrClN3OS
InChI:InChI=1S/C12H13BrClN3OS/c1-7-8(6-13)19-10-9(7)15-12(14)16-11(10)17-2-4-18-5-3-17/h2-6H2,1H3
InChI key:InChIKey=VTYFGCCALLEYKP-UHFFFAOYSA-N
SMILES:CC=1C=2C(=C(N=C(Cl)N2)N3CCOCC3)SC1CBr
Synonyms:
  • Thieno[3,2-d]pyrimidine, 6-(bromomethyl)-2-chloro-7-methyl-4-(4-morpholinyl)-
  • 6-(Bromomethyl)-2-chloro-7-methyl-4-(4-morpholinyl)thieno[3,2-d]pyrimidine
  • 6-Bromomethyl-2-chloro-7-methyl-4-(morpholin-4-yl)thieno[3,2-d]pyrimidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.