CAS 1032758-82-9
:tert-butyl N-methyl-N-[3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridyl]carbamate
Description:
Tert-butyl N-methyl-N-[3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridyl]carbamate is a chemical compound characterized by its complex structure, which includes a tert-butyl group, a carbamate functional group, and a pyridine ring substituted with a boron-containing moiety. This compound is typically used in organic synthesis and medicinal chemistry due to its potential as a building block for various chemical reactions. The presence of the dioxaborolane group suggests it may participate in boron-mediated reactions, which are valuable in the formation of carbon-carbon bonds. The compound's solubility, stability, and reactivity can be influenced by the steric and electronic properties of its substituents. Additionally, the pyridine ring may impart specific biological activities, making it of interest in drug development. Overall, this compound exemplifies the intricate design often found in modern synthetic chemistry, where functional groups are strategically incorporated to achieve desired chemical properties and reactivity.
Formula:C18H29BN2O4
InChI:InChI=1/C18H29BN2O4/c1-12-10-13(19-24-17(5,6)18(7,8)25-19)11-20-14(12)21(9)15(22)23-16(2,3)4/h10-11H,1-9H3
SMILES:Cc1cc(cnc1N(C)C(=O)OC(C)(C)C)B1OC(C)(C)C(C)(C)O1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
6-(Boc-methylamino)-5-methylpyridine-3-boronic acid pinacol ester
CAS:Formula:C18H29BN2O4Color and Shape:SolidMolecular weight:348.2449
