CAS 1032758-87-4
:tert-butyl N-methyl-N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridyl]carbamate
Description:
Tert-butyl N-methyl-N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridyl]carbamate is a chemical compound characterized by its complex structure, which includes a tert-butyl group, a pyridine ring, and a dioxaborolane moiety. The presence of the tert-butyl group contributes to its hydrophobic properties, while the pyridine ring can participate in various chemical interactions due to its nitrogen atom. The dioxaborolane component is notable for its ability to form stable complexes with various substrates, making this compound potentially useful in synthetic organic chemistry, particularly in the context of boron chemistry. The carbamate functional group indicates that the compound may exhibit properties typical of carbamates, such as potential reactivity with nucleophiles. Overall, this compound's unique structural features suggest it may have applications in medicinal chemistry or as a reagent in organic synthesis, although specific reactivity and application details would depend on further experimental investigation.
Formula:C17H27BN2O4
InChI:InChI=1/C17H27BN2O4/c1-15(2,3)22-14(21)20(8)13-10-9-12(11-19-13)18-23-16(4,5)17(6,7)24-18/h9-11H,1-8H3
SMILES:CC(C)(C)OC(=O)N(C)c1ccc(cn1)B1OC(C)(C)C(C)(C)O1
Synonyms:- T6Nj Bn1& Vox1& 1& 1 E- Bt5Obotj D1 D1 E1 E1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
6-(N-Boc-methylamino)pyridine-3-boronic acid pinacol ester, 95%
CAS:<p>Used in the synthesis of organic compounds. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as </p>Formula:C17H27BN2O4Purity:95%Color and Shape:White to pale cream, PowderMolecular weight:334.22TERT-BUTYL N-METHYL-N-[5-(4,4,5,5-TETRAMETHYL-[1,3,2]DIOXABOROLAN-2-YL)PYRIDIN-2-YL]CARBAMATE
CAS:Formula:C17H27BN2O4Purity:97%Color and Shape:SolidMolecular weight:334.21836-(Boc-methylamino)pyridine-3-boronic acid, pinacol ester
CAS:6-(Boc-methylamino)pyridine-3-boronic acid, pinacol esterPurity:≥95%Molecular weight:334.22g/moltert-Butyl methyl(5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-yl)carbamate
CAS:Formula:C17H27BN2O4Purity:97%Molecular weight:334.22



