CAS 10328-52-6

N,N'-benzene-1,4-diylbis(2-bromoacetamide)

Description:

N,N'-Benzene-1,4-diylbis(2-bromoacetamide), with the CAS number 10328-52-6, is an organic compound characterized by its structure, which features a benzene ring substituted with two bromoacetamide groups at the 1 and 4 positions. This compound typically exhibits properties associated with amides, including potential solubility in polar solvents due to the presence of the amide functional groups. The bromo substituents can impart reactivity, making it useful in various chemical reactions, such as nucleophilic substitutions. The presence of bromine atoms also suggests that the compound may have applications in medicinal chemistry or as an intermediate in organic synthesis. Additionally, the compound's molecular structure may influence its physical properties, such as melting and boiling points, as well as its stability under different conditions. As with many organic compounds, safety precautions should be taken when handling this substance, as it may pose health risks or environmental hazards.

Formula: C₁₀H₁₀Br₂N₂O₂

InChI: InChI=1/C10H10Br2N2O2/c11-5-9(15)13-7-1-2-8(4-3-7)14-10(16)6-12/h1-4H,5-6H2,(H,13,15)(H,14,16)

SMILES: c1cc(ccc1NC(=O)CBr)NC(=O)CBr

N,N'-(1,4-Phenylene)bis(2-bromoacetamide)

CAS: 10328-52-6

N,N'-(1,4-Phenylene)bis(2-bromoacetamide)

Purity: 95%

Molecular weight: 350.01g/mol

Ref: 54-OR1073114

N,N'-1,4-Phenylenebis[2-bromoacetamide]

Controlled Product

CAS: 10328-52-6

Formula: C₁₀H₁₀Br₂N₂O₂

Color and Shape: Neat

Molecular weight: 350.007

Ref: TR-P319863