CAS 10328-87-7

Methyl 2,3-dichlorophenylacetate

Description:

Methyl 2,3-dichlorophenylacetate is an organic compound characterized by its ester functional group, derived from the reaction of 2,3-dichlorophenylacetic acid and methanol. It typically appears as a colorless to pale yellow liquid with a distinctive odor. The presence of chlorine atoms in the phenyl ring contributes to its chemical reactivity and potential biological activity. This compound is often used in organic synthesis and may serve as an intermediate in the production of various pharmaceuticals and agrochemicals. Its molecular structure includes a methyl ester group, which enhances its solubility in organic solvents. Methyl 2,3-dichlorophenylacetate is subject to regulations due to its potential environmental impact and toxicity, necessitating careful handling and disposal. As with many chlorinated compounds, it may exhibit properties such as persistence in the environment and bioaccumulation. Safety data sheets should be consulted for specific handling precautions, as exposure can pose health risks. Overall, this compound exemplifies the complexity and utility of halogenated organic molecules in chemical applications.

Formula: C₉H₈Cl₂O₂

InChI: InChI=1/C9H8Cl2O2/c1-13-8(12)5-6-3-2-4-7(10)9(6)11/h2-4H,5H2,1H3

SMILES: COC(=O)Cc1cccc(c1Cl)Cl

METHYL 2,3-DICHLOROPHENYLACETATE

CAS: 10328-87-7

Formula: C₉H₈Cl₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 219.0646

Ref: IN-DA003RLJ

Methyl 2,3-dichlorophenylacetate

CAS: 10328-87-7

Methyl 2,3-dichlorophenylacetate

Purity: 98%

Color and Shape: Liquid

Molecular weight: 219.07g/mol

Ref: 54-OR951268

METHYL 2,3-DICHLOROPHENYLACETATE

CAS: 10328-87-7

Formula: C₉H₈Cl₂O₂

Purity: 97%

Color and Shape: Liquid

Molecular weight: 219.06

Ref: 10-F386875