CAS 1032825-20-9

6-[4-(Methylsulfonyl)phenyl]-3-pyridinol

Description:

6-[4-(Methylsulfonyl)phenyl]-3-pyridinol, identified by its CAS number 1032825-20-9, is an organic compound characterized by its pyridine and phenyl functional groups. This compound features a pyridinol structure, which includes a hydroxyl group (-OH) attached to the pyridine ring, contributing to its potential as a weak acid. The presence of a methylsulfonyl group (-SO2CH3) on the phenyl ring enhances its solubility in polar solvents and may influence its biological activity. The compound is likely to exhibit moderate to high polarity due to the sulfonyl and hydroxyl functionalities, which can engage in hydrogen bonding. Its structural characteristics suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar structures often exhibit biological activity. Additionally, the presence of the methylsulfonyl group may impart unique electronic properties, affecting the compound's reactivity and interaction with biological targets. Overall, 6-[4-(Methylsulfonyl)phenyl]-3-pyridinol represents a versatile structure with potential implications in various chemical and biological contexts.

Formula: C₁₂H₁₁NO₃S

InChI: InChI=1S/C12H11NO3S/c1-17(15,16)11-5-2-9(3-6-11)12-7-4-10(14)8-13-12/h2-8,14H,1H3

InChI key: InChIKey=PTUPRGVDEBLUCK-UHFFFAOYSA-N

SMILES: S(C)(=O)(=O)C1=CC=C(C=C1)C2=CC=C(O)C=N2

Synonyms:

• 3-Pyridinol, 6-[4-(methylsulfonyl)phenyl]-
• 6-[4-(Methylsulfonyl)phenyl]-3-pyridinol

5-Hydroxy-2-(4-methylsulfonylphenyl)pyridine

CAS: 1032825-20-9

Formula: C₁₂H₁₁NO₃S

Molecular weight: 249.2856

Ref: IN-DA009427