CymitQuimica logo

CAS 103290-41-1

:

(2R,4R)-4-phenylpyrrolidine-2-carboxylic acid

Description:
(2R,4R)-4-phenylpyrrolidine-2-carboxylic acid, also known as a pyrrolidine derivative, is characterized by its chiral centers at the 2 and 4 positions of the pyrrolidine ring, which contributes to its stereochemistry and potential biological activity. This compound features a phenyl group attached to the 4-position of the pyrrolidine, enhancing its lipophilicity and possibly influencing its interaction with biological targets. The carboxylic acid functional group at the 2-position is significant for its acidity and ability to participate in hydrogen bonding, which can affect solubility and reactivity. The compound may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can mimic natural amino acids. Its stereochemistry is crucial for its biological activity, as different enantiomers can have vastly different effects in biological systems. Overall, (2R,4R)-4-phenylpyrrolidine-2-carboxylic acid is a compound of interest in both synthetic and medicinal chemistry contexts.
Formula:C11H13NO2
InChI:InChI=1/C11H13NO2/c13-11(14)10-6-9(7-12-10)8-4-2-1-3-5-8/h1-5,9-10,12H,6-7H2,(H,13,14)/t9-,10+/m0/s1
Synonyms:
  • (4R)-4-Phenyl-D-proline
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.